C23H29N3O5 — CID 143408561
N-[2-[[(3E,5Z)-2,6-diaminohexa-3,5-dien-3-yl]oxymethyl]phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 143408561) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is N-[2-[[(3E,5Z)-2,6-diaminohexa-3,5-dien-3-yl]oxymethyl]phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[[(3E,5Z)-2,6-diaminohexa-3,5-dien-3-yl]oxymethyl]phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 143408561 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | N-[2-[[(3E,5Z)-2,6-diaminohexa-3,5-dien-3-yl]oxymethyl]phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2CO/C(=C/C=C\N)C(C)N)cc(OC)c1OC |
| InChI | InChI=1S/C23H29N3O5/c1-15(25)19(10-7-11-24)31-14-16-8-5-6-9-18(16)26-23(27)17-12-20(28-2)22(30-4)21(13-17)29-3/h5-13,15H,14,24-25H2,1-4H3,(H,26,27)/b11-7-,19-10+ |
| InChIKey | LAIVNPUVZWWQSL-WMUKWCMQSA-N |
| XLogP | 3.18 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|