C11H9N5O5 — CID 118419661
methyl 4-[(6-nitro-3-pyridinyl)carbamoyl]-1H-imidazole-5-carboxylate (PubChem CID 118419661) has the molecular formula C11H9N5O5 and a molecular weight of 291.22 g/mol. Its IUPAC name is methyl 4-[(6-nitro-3-pyridinyl)carbamoyl]-1H-imidazole-5-carboxylate.
| Compound Name | methyl 4-[(6-nitro-3-pyridinyl)carbamoyl]-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 118419661 |
| Molecular Formula | C11H9N5O5 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | methyl 4-[(6-nitro-3-pyridinyl)carbamoyl]-1H-imidazole-5-carboxylate |
| SMILES | COC(=O)c1[nH]cnc1C(=O)Nc1ccc([N+](=O)[O-])nc1 |
| InChI | InChI=1S/C11H9N5O5/c1-21-11(18)9-8(13-5-14-9)10(17)15-6-2-3-7(12-4-6)16(19)20/h2-5H,1H3,(H,13,14)(H,15,17) |
| InChIKey | HSOVJSIJMVUPAO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|