C14H10BrN3O6 — CID 17358287
3-bromo-N-(4-methoxy-3,5-dinitrophenyl)benzamide (PubChem CID 17358287) has the molecular formula C14H10BrN3O6 and a molecular weight of 396.15 g/mol. Its IUPAC name is 3-bromo-N-(4-methoxy-3,5-dinitrophenyl)benzamide.
| Compound Name | 3-bromo-N-(4-methoxy-3,5-dinitrophenyl)benzamide |
|---|---|
| PubChem CID | 17358287 |
| Molecular Formula | C14H10BrN3O6 |
| Molecular Weight | 396.15 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | 3-bromo-N-(4-methoxy-3,5-dinitrophenyl)benzamide |
| SMILES | COc1c([N+](=O)[O-])cc(NC(=O)c2cccc(Br)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10BrN3O6/c1-24-13-11(17(20)21)6-10(7-12(13)18(22)23)16-14(19)8-3-2-4-9(15)5-8/h2-7H,1H3,(H,16,19) |
| InChIKey | INFUAVBHDVTTRA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.15 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|