C21H27F3IN5O2 — CID 109378945
N-[4-[[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 109378945) has the molecular formula C21H27F3IN5O2 and a molecular weight of 565.38 g/mol. Its IUPAC name is N-[4-[[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[4-[[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109378945 |
| Molecular Formula | C21H27F3IN5O2 |
| Molecular Weight | 565.38 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | N-[4-[[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(NC(=O)c2ccco2)cc1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C21H26F3N5O2.HI/c1-15(21(22,23)24)28-9-11-29(12-10-28)20(25-2)26-14-16-5-7-17(8-6-16)27-19(30)18-4-3-13-31-18;/h3-8,13,15H,9-12,14H2,1-2H3,(H,25,26)(H,27,30);1H |
| InChIKey | GKYPXKOERAYUSM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|