C26H31N5O2 — CID 111132701
4-(2-methoxyphenyl)-N'-methyl-N-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]piperazine-1-carboximidamide (PubChem CID 111132701) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-N'-methyl-N-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2-methoxyphenyl)-N'-methyl-N-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111132701 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 4-(2-methoxyphenyl)-N'-methyl-N-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(Cn2ccccc2=O)cc1)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C26H31N5O2/c1-27-26(30-17-15-29(16-18-30)23-7-3-4-8-24(23)33-2)28-19-21-10-12-22(13-11-21)20-31-14-6-5-9-25(31)32/h3-14H,15-20H2,1-2H3,(H,27,28) |
| InChIKey | INYLPXHCSDTFPO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 62.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|