C24H27N3O — CID 141146034
2-methyl-1-(3-trityloxypropyl)guanidine (PubChem CID 141146034) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-methyl-1-(3-trityloxypropyl)guanidine.
| Compound Name | 2-methyl-1-(3-trityloxypropyl)guanidine |
|---|---|
| PubChem CID | 141146034 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 2-methyl-1-(3-trityloxypropyl)guanidine |
| SMILES | C/N=C(\N)NCCCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27N3O/c1-26-23(25)27-18-11-19-28-24(20-12-5-2-6-13-20,21-14-7-3-8-15-21)22-16-9-4-10-17-22/h2-10,12-17H,11,18-19H2,1H3,(H3,25,26,27) |
| InChIKey | JGXKOYGMYDUTIU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|