C32H43N3O — CID 25020463
2-methyl-1-octyl-3-(3-trityloxypropyl)guanidine (PubChem CID 25020463) has the molecular formula C32H43N3O and a molecular weight of 485.72 g/mol. Its IUPAC name is 2-methyl-1-octyl-3-(3-trityloxypropyl)guanidine.
| Compound Name | 2-methyl-1-octyl-3-(3-trityloxypropyl)guanidine |
|---|---|
| PubChem CID | 25020463 |
| Molecular Formula | C32H43N3O |
| Molecular Weight | 485.72 g/mol |
| Exact Mass | 485.34 |
| IUPAC Name | 2-methyl-1-octyl-3-(3-trityloxypropyl)guanidine |
| SMILES | CCCCCCCCN/C(=N\C)NCCCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H43N3O/c1-3-4-5-6-7-17-25-34-31(33-2)35-26-18-27-36-32(28-19-11-8-12-20-28,29-21-13-9-14-22-29)30-23-15-10-16-24-30/h8-16,19-24H,3-7,17-18,25-27H2,1-2H3,(H2,33,34,35) |
| InChIKey | KEAJKTZPOVPHGO-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.72 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|