C21H30N2O5 — CID 4116688
[2-(cyclohexylamino)-2-oxoethyl] 3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 4116688) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 4116688 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)OCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C21H30N2O5/c1-15(2)19(23-21(26)28-13-16-9-5-3-6-10-16)20(25)27-14-18(24)22-17-11-7-4-8-12-17/h3,5-6,9-10,15,17,19H,4,7-8,11-14H2,1-2H3,(H,22,24)(H,23,26) |
| InChIKey | DVKNKUDTNDSQAO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |