C23H21FN4O5 — CID 24572577
[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 7-fluoro-2-methylquinoline-3-carboxylate (PubChem CID 24572577) has the molecular formula C23H21FN4O5 and a molecular weight of 452.44 g/mol. Its IUPAC name is [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 7-fluoro-2-methylquinoline-3-carboxylate.
| Compound Name | [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 7-fluoro-2-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 24572577 |
| Molecular Formula | C23H21FN4O5 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 7-fluoro-2-methylquinoline-3-carboxylate |
| SMILES | Cc1nc2cc(F)ccc2cc1C(=O)OCC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C23H21FN4O5/c1-15-20(12-16-2-3-17(24)13-21(16)25-15)23(30)33-14-22(29)27-10-8-26(9-11-27)18-4-6-19(7-5-18)28(31)32/h2-7,12-13H,8-11,14H2,1H3 |
| InChIKey | OLGQNKYGWVDUIU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 105.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|