C23H24N6O5 — CID 55704082
[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate (PubChem CID 55704082) has the molecular formula C23H24N6O5 and a molecular weight of 464.48 g/mol. Its IUPAC name is [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate.
| Compound Name | [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55704082 |
| Molecular Formula | C23H24N6O5 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)OCC(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)cn2)n1 |
| InChI | InChI=1S/C23H24N6O5/c1-16-13-17(2)28(25-16)21-8-3-18(14-24-21)23(31)34-15-22(30)27-11-9-26(10-12-27)19-4-6-20(7-5-19)29(32)33/h3-8,13-14H,9-12,15H2,1-2H3 |
| InChIKey | SXNACELNIRPENC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 123.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|