C23H27N5O2 — CID 55917792
[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone (PubChem CID 55917792) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is [6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | [6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 55917792 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | [6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone |
| SMILES | COc1ccc(N2CCCN(C(=O)c3ccc(-n4nc(C)cc4C)nc3)CC2)cc1 |
| InChI | InChI=1S/C23H27N5O2/c1-17-15-18(2)28(25-17)22-10-5-19(16-24-22)23(29)27-12-4-11-26(13-14-27)20-6-8-21(30-3)9-7-20/h5-10,15-16H,4,11-14H2,1-3H3 |
| InChIKey | DBIHPHJSVPGURU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|