C25H26N4O5 — CID 42985685
[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-ethyl-3-methylquinoline-4-carboxylate (PubChem CID 42985685) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-ethyl-3-methylquinoline-4-carboxylate.
| Compound Name | [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-ethyl-3-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 42985685 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-ethyl-3-methylquinoline-4-carboxylate |
| SMILES | CCc1nc2ccccc2c(C(=O)OCC(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)c1C |
| InChI | InChI=1S/C25H26N4O5/c1-3-21-17(2)24(20-6-4-5-7-22(20)26-21)25(31)34-16-23(30)28-14-12-27(13-15-28)18-8-10-19(11-9-18)29(32)33/h4-11H,3,12-16H2,1-2H3 |
| InChIKey | BKGBPKHJFCOYOY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 105.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|