C23H28N2O5S2 — CID 55883528
methyl 2-[2-[[3-(azepan-1-ylsulfonyl)phenyl]carbamoyl]phenyl]sulfanylpropanoate (PubChem CID 55883528) has the molecular formula C23H28N2O5S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is methyl 2-[2-[[3-(azepan-1-ylsulfonyl)phenyl]carbamoyl]phenyl]sulfanylpropanoate.
| Compound Name | methyl 2-[2-[[3-(azepan-1-ylsulfonyl)phenyl]carbamoyl]phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 55883528 |
| Molecular Formula | C23H28N2O5S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | methyl 2-[2-[[3-(azepan-1-ylsulfonyl)phenyl]carbamoyl]phenyl]sulfanylpropanoate |
| SMILES | COC(=O)C(C)Sc1ccccc1C(=O)Nc1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C23H28N2O5S2/c1-17(23(27)30-2)31-21-13-6-5-12-20(21)22(26)24-18-10-9-11-19(16-18)32(28,29)25-14-7-3-4-8-15-25/h5-6,9-13,16-17H,3-4,7-8,14-15H2,1-2H3,(H,24,26) |
| InChIKey | POXYWQGUNDYBRQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |