C21H24N2O5S3 — CID 41188393
2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide (PubChem CID 41188393) has the molecular formula C21H24N2O5S3 and a molecular weight of 480.63 g/mol. Its IUPAC name is 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 41188393 |
| Molecular Formula | C21H24N2O5S3 |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCCC2)c1)c1ccccc1S[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H24N2O5S3/c24-21(19-8-1-2-9-20(19)29-17-10-13-30(25,26)15-17)22-16-6-5-7-18(14-16)31(27,28)23-11-3-4-12-23/h1-2,5-9,14,17H,3-4,10-13,15H2,(H,22,24)/t17-/m0/s1 |
| InChIKey | GHEAKAPBSAMOQU-KRWDZBQOSA-N |
| XLogP | 3.00 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |