C19H19FN2O4S2 — CID 24673847
N-(5-acetamido-2-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)sulfanylbenzamide (PubChem CID 24673847) has the molecular formula C19H19FN2O4S2 and a molecular weight of 422.50 g/mol. Its IUPAC name is N-(5-acetamido-2-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)sulfanylbenzamide.
| Compound Name | N-(5-acetamido-2-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)sulfanylbenzamide |
|---|---|
| PubChem CID | 24673847 |
| Molecular Formula | C19H19FN2O4S2 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | N-(5-acetamido-2-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)sulfanylbenzamide |
| SMILES | CC(=O)Nc1ccc(F)c(NC(=O)c2ccccc2SC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C19H19FN2O4S2/c1-12(23)21-13-6-7-16(20)17(10-13)22-19(24)15-4-2-3-5-18(15)27-14-8-9-28(25,26)11-14/h2-7,10,14H,8-9,11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | LYVYSVGRXAFVHS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |