C23H21NO4S2 — CID 25481443
2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-(3-phenoxyphenyl)benzamide (PubChem CID 25481443) has the molecular formula C23H21NO4S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-(3-phenoxyphenyl)benzamide.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-(3-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 25481443 |
| Molecular Formula | C23H21NO4S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-(3-phenoxyphenyl)benzamide |
| SMILES | O=C(Nc1cccc(Oc2ccccc2)c1)c1ccccc1S[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H21NO4S2/c25-23(21-11-4-5-12-22(21)29-20-13-14-30(26,27)16-20)24-17-7-6-10-19(15-17)28-18-8-2-1-3-9-18/h1-12,15,20H,13-14,16H2,(H,24,25)/t20-/m1/s1 |
| InChIKey | ROGSNESYFKZBKP-HXUWFJFHSA-N |
| XLogP | 5.01 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |