C19H21NO3S2 — CID 9042585
N-(2,5-dimethylphenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide (PubChem CID 9042585) has the molecular formula C19H21NO3S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide |
|---|---|
| PubChem CID | 9042585 |
| Molecular Formula | C19H21NO3S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2ccccc2S[C@@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C19H21NO3S2/c1-13-7-8-14(2)17(11-13)20-19(21)16-5-3-4-6-18(16)24-15-9-10-25(22,23)12-15/h3-8,11,15H,9-10,12H2,1-2H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | ALBIVDFOKMYJGM-OAHLLOKOSA-N |
| XLogP | 3.83 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |