C18H18ClNO3S2 — CID 9044469
N-(2-chloro-4-methylphenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide (PubChem CID 9044469) has the molecular formula C18H18ClNO3S2 and a molecular weight of 395.93 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide |
|---|---|
| PubChem CID | 9044469 |
| Molecular Formula | C18H18ClNO3S2 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2S[C@@H]2CCS(=O)(=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C18H18ClNO3S2/c1-12-6-7-16(15(19)10-12)20-18(21)14-4-2-3-5-17(14)24-13-8-9-25(22,23)11-13/h2-7,10,13H,8-9,11H2,1H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | AWGFJVJADVANRD-CYBMUJFWSA-N |
| XLogP | 4.18 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |