C16H21NO3S2 — CID 40939084
N-cyclopentyl-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide (PubChem CID 40939084) has the molecular formula C16H21NO3S2 and a molecular weight of 339.48 g/mol. Its IUPAC name is N-cyclopentyl-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide.
| Compound Name | N-cyclopentyl-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide |
|---|---|
| PubChem CID | 40939084 |
| Molecular Formula | C16H21NO3S2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-cyclopentyl-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide |
| SMILES | O=C(NC1CCCC1)c1ccccc1S[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H21NO3S2/c18-16(17-12-5-1-2-6-12)14-7-3-4-8-15(14)21-13-9-10-22(19,20)11-13/h3-4,7-8,12-13H,1-2,5-6,9-11H2,(H,17,18)/t13-/m1/s1 |
| InChIKey | KWAZAQAURKATJA-CYBMUJFWSA-N |
| XLogP | 2.64 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |