C19H21NO3S3 — CID 26820093
2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(2-phenylsulfanylethyl)benzamide (PubChem CID 26820093) has the molecular formula C19H21NO3S3 and a molecular weight of 407.58 g/mol. Its IUPAC name is 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(2-phenylsulfanylethyl)benzamide.
| Compound Name | 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(2-phenylsulfanylethyl)benzamide |
|---|---|
| PubChem CID | 26820093 |
| Molecular Formula | C19H21NO3S3 |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(2-phenylsulfanylethyl)benzamide |
| SMILES | O=C(NCCSc1ccccc1)c1ccccc1S[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H21NO3S3/c21-19(20-11-12-24-15-6-2-1-3-7-15)17-8-4-5-9-18(17)25-16-10-13-26(22,23)14-16/h1-9,16H,10-14H2,(H,20,21)/t16-/m0/s1 |
| InChIKey | FXQNWEFPUSVTDX-INIZCTEOSA-N |
| XLogP | 3.49 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|