C19H20O4S2 — CID 51923856
2-phenylethyl 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate (PubChem CID 51923856) has the molecular formula C19H20O4S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-phenylethyl 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate.
| Compound Name | 2-phenylethyl 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 51923856 |
| Molecular Formula | C19H20O4S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-phenylethyl 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate |
| SMILES | O=C(OCCc1ccccc1)c1ccccc1S[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H20O4S2/c20-19(23-12-10-15-6-2-1-3-7-15)17-8-4-5-9-18(17)24-16-11-13-25(21,22)14-16/h1-9,16H,10-14H2/t16-/m1/s1 |
| InChIKey | DTXOKYLHXKXPJE-MRXNPFEDSA-N |
| XLogP | 3.37 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |