C22H20O4S2 — CID 8665444
naphthalen-1-ylmethyl 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate (PubChem CID 8665444) has the molecular formula C22H20O4S2 and a molecular weight of 412.53 g/mol. Its IUPAC name is naphthalen-1-ylmethyl 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate.
| Compound Name | naphthalen-1-ylmethyl 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 8665444 |
| Molecular Formula | C22H20O4S2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | naphthalen-1-ylmethyl 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate |
| SMILES | O=C(OCc1cccc2ccccc12)c1ccccc1S[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H20O4S2/c23-22(26-14-17-8-5-7-16-6-1-2-9-19(16)17)20-10-3-4-11-21(20)27-18-12-13-28(24,25)15-18/h1-11,18H,12-15H2/t18-/m1/s1 |
| InChIKey | DPTXQDUYXTZBSO-GOSISDBHSA-N |
| XLogP | 4.48 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |