C16H17NO5S2 — CID 8665688
[2-oxo-2-(prop-2-ynylamino)ethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylbenzoate (PubChem CID 8665688) has the molecular formula C16H17NO5S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylbenzoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 8665688 |
| Molecular Formula | C16H17NO5S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylbenzoate |
| SMILES | C#CCNC(=O)COC(=O)c1ccccc1S[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H17NO5S2/c1-2-8-17-15(18)10-22-16(19)13-5-3-4-6-14(13)23-12-7-9-24(20,21)11-12/h1,3-6,12H,7-11H2,(H,17,18)/t12-/m0/s1 |
| InChIKey | JHLFKOBJFHIIOY-LBPRGKRZSA-N |
| XLogP | 0.87 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|