C13H13NO4S2 — CID 8665331
cyanomethyl 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate (PubChem CID 8665331) has the molecular formula C13H13NO4S2 and a molecular weight of 311.38 g/mol. Its IUPAC name is cyanomethyl 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate.
| Compound Name | cyanomethyl 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 8665331 |
| Molecular Formula | C13H13NO4S2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | cyanomethyl 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate |
| SMILES | N#CCOC(=O)c1ccccc1S[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H13NO4S2/c14-6-7-18-13(15)11-3-1-2-4-12(11)19-10-5-8-20(16,17)9-10/h1-4,10H,5,7-9H2/t10-/m1/s1 |
| InChIKey | KYCCCCQKKQUXNL-SNVBAGLBSA-N |
| XLogP | 1.65 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |