C14H15NO3S2 — CID 39967836
2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-prop-2-ynylbenzamide (PubChem CID 39967836) has the molecular formula C14H15NO3S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-prop-2-ynylbenzamide.
| Compound Name | 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 39967836 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1ccccc1S[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H15NO3S2/c1-2-8-15-14(16)12-5-3-4-6-13(12)19-11-7-9-20(17,18)10-11/h1,3-6,11H,7-10H2,(H,15,16)/t11-/m0/s1 |
| InChIKey | LDRVJGZLJWFMOU-NSHDSACASA-N |
| XLogP | 1.33 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|