C21H25NO3S2 — CID 9044149
N-(4-tert-butylphenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide (PubChem CID 9044149) has the molecular formula C21H25NO3S2 and a molecular weight of 403.57 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide.
| Compound Name | N-(4-tert-butylphenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide |
|---|---|
| PubChem CID | 9044149 |
| Molecular Formula | C21H25NO3S2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2ccccc2S[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C21H25NO3S2/c1-21(2,3)15-8-10-16(11-9-15)22-20(23)18-6-4-5-7-19(18)26-17-12-13-27(24,25)14-17/h4-11,17H,12-14H2,1-3H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | BDBPGGFBGKCQCB-QGZVFWFLSA-N |
| XLogP | 4.52 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |