C24H23NO4S2 — CID 41142434
2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-[4-(3-methylphenoxy)phenyl]benzamide (PubChem CID 41142434) has the molecular formula C24H23NO4S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-[4-(3-methylphenoxy)phenyl]benzamide.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-[4-(3-methylphenoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 41142434 |
| Molecular Formula | C24H23NO4S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-[4-(3-methylphenoxy)phenyl]benzamide |
| SMILES | Cc1cccc(Oc2ccc(NC(=O)c3ccccc3S[C@@H]3CCS(=O)(=O)C3)cc2)c1 |
| InChI | InChI=1S/C24H23NO4S2/c1-17-5-4-6-20(15-17)29-19-11-9-18(10-12-19)25-24(26)22-7-2-3-8-23(22)30-21-13-14-31(27,28)16-21/h2-12,15,21H,13-14,16H2,1H3,(H,25,26)/t21-/m1/s1 |
| InChIKey | FEPCIKACTZCYPF-OAQYLSRUSA-N |
| XLogP | 5.32 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |