C14H14N2O3S3 — CID 9043751
2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 9043751) has the molecular formula C14H14N2O3S3 and a molecular weight of 354.48 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 9043751 |
| Molecular Formula | C14H14N2O3S3 |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1ccccc1S[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H14N2O3S3/c17-13(16-14-15-6-7-20-14)11-3-1-2-4-12(11)21-10-5-8-22(18,19)9-10/h1-4,6-7,10H,5,8-9H2,(H,15,16,17)/t10-/m1/s1 |
| InChIKey | PNVJPDAKXIVAGV-SNVBAGLBSA-N |
| XLogP | 2.67 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |