C15H17N3O3S4 — CID 9045692
2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 9045692) has the molecular formula C15H17N3O3S4 and a molecular weight of 415.59 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 9045692 |
| Molecular Formula | C15H17N3O3S4 |
| Molecular Weight | 415.59 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCSc1nnc(NC(=O)c2ccccc2S[C@@H]2CCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C15H17N3O3S4/c1-2-22-15-18-17-14(24-15)16-13(19)11-5-3-4-6-12(11)23-10-7-8-25(20,21)9-10/h3-6,10H,2,7-9H2,1H3,(H,16,17,19)/t10-/m1/s1 |
| InChIKey | GSVGPSSYZZZBJW-SNVBAGLBSA-N |
| XLogP | 3.18 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|