C15H16N2O2S2 — CID 9043774
2-[[(2R)-oxolan-2-yl]methylsulfanyl]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 9043774) has the molecular formula C15H16N2O2S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-[[(2R)-oxolan-2-yl]methylsulfanyl]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-[[(2R)-oxolan-2-yl]methylsulfanyl]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 9043774 |
| Molecular Formula | C15H16N2O2S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-[[(2R)-oxolan-2-yl]methylsulfanyl]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1ccccc1SC[C@H]1CCCO1 |
| InChI | InChI=1S/C15H16N2O2S2/c18-14(17-15-16-7-9-20-15)12-5-1-2-6-13(12)21-10-11-4-3-8-19-11/h1-2,5-7,9,11H,3-4,8,10H2,(H,16,17,18)/t11-/m1/s1 |
| InChIKey | WQVRIDQSWBQZMR-LLVKDONJSA-N |
| XLogP | 3.67 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |