C20H19N3O2S2 — CID 75479052
2-(oxolan-2-ylmethylsulfanyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 75479052) has the molecular formula C20H19N3O2S2 and a molecular weight of 397.53 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylsulfanyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-(oxolan-2-ylmethylsulfanyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 75479052 |
| Molecular Formula | C20H19N3O2S2 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 2-(oxolan-2-ylmethylsulfanyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2cccnc2)cs1)c1ccccc1SCC1CCCO1 |
| InChI | InChI=1S/C20H19N3O2S2/c24-19(23-20-22-17(13-27-20)14-5-3-9-21-11-14)16-7-1-2-8-18(16)26-12-15-6-4-10-25-15/h1-3,5,7-9,11,13,15H,4,6,10,12H2,(H,22,23,24) |
| InChIKey | WSZLWRIUCKJUHY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |