C17H23NO6S2 — CID 9385162
[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate (PubChem CID 9385162) has the molecular formula C17H23NO6S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate.
| Compound Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 9385162 |
| Molecular Formula | C17H23NO6S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylbenzoate |
| SMILES | COCCNC(=O)[C@@H](C)OC(=O)c1ccccc1S[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H23NO6S2/c1-12(16(19)18-8-9-23-2)24-17(20)14-5-3-4-6-15(14)25-13-7-10-26(21,22)11-13/h3-6,12-13H,7-11H2,1-2H3,(H,18,19)/t12-,13-/m1/s1 |
| InChIKey | KLITUIMIJWRDSK-CHWSQXEVSA-N |
| XLogP | 1.27 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|