C18H18O4S2 — CID 8665350
benzyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylbenzoate (PubChem CID 8665350) has the molecular formula C18H18O4S2 and a molecular weight of 362.47 g/mol. Its IUPAC name is benzyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylbenzoate.
| Compound Name | benzyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 8665350 |
| Molecular Formula | C18H18O4S2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | benzyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylbenzoate |
| SMILES | O=C(OCc1ccccc1)c1ccccc1S[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H18O4S2/c19-18(22-12-14-6-2-1-3-7-14)16-8-4-5-9-17(16)23-15-10-11-24(20,21)13-15/h1-9,15H,10-13H2/t15-/m0/s1 |
| InChIKey | IHFOTMAJJAXPQS-HNNXBMFYSA-N |
| XLogP | 3.32 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |