C24H24N4O6S — CID 26565696
2-[(4R)-4-(1-benzofuran-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 26565696) has the molecular formula C24H24N4O6S and a molecular weight of 496.55 g/mol. Its IUPAC name is 2-[(4R)-4-(1-benzofuran-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(4R)-4-(1-benzofuran-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 26565696 |
| Molecular Formula | C24H24N4O6S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 2-[(4R)-4-(1-benzofuran-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | C[C@]1(c2cc3ccccc3o2)NC(=O)N(CC(=O)Nc2cccc(S(=O)(=O)N3CCCC3)c2)C1=O |
| InChI | InChI=1S/C24H24N4O6S/c1-24(20-13-16-7-2-3-10-19(16)34-20)22(30)28(23(31)26-24)15-21(29)25-17-8-6-9-18(14-17)35(32,33)27-11-4-5-12-27/h2-3,6-10,13-14H,4-5,11-12,15H2,1H3,(H,25,29)(H,26,31)/t24-/m1/s1 |
| InChIKey | GJNDNLBRRHVRFL-XMMPIXPASA-N |
| XLogP | 2.62 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|