C18H21N3O4 — CID 17397156
2-[4-(1-benzofuran-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-butylacetamide (PubChem CID 17397156) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-[4-(1-benzofuran-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-butylacetamide.
| Compound Name | 2-[4-(1-benzofuran-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-butylacetamide |
|---|---|
| PubChem CID | 17397156 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-[4-(1-benzofuran-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-butylacetamide |
| SMILES | CCCCNC(=O)CN1C(=O)NC(C)(c2cc3ccccc3o2)C1=O |
| InChI | InChI=1S/C18H21N3O4/c1-3-4-9-19-15(22)11-21-16(23)18(2,20-17(21)24)14-10-12-7-5-6-8-13(12)25-14/h5-8,10H,3-4,9,11H2,1-2H3,(H,19,22)(H,20,24) |
| InChIKey | DPVNGSCCANZUCS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|