C18H20N2O4 — CID 40854425
(5S)-5-(1-benzofuran-2-yl)-3-(3,3-dimethyl-2-oxobutyl)-5-methylimidazolidine-2,4-dione (PubChem CID 40854425) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is (5S)-5-(1-benzofuran-2-yl)-3-(3,3-dimethyl-2-oxobutyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-(1-benzofuran-2-yl)-3-(3,3-dimethyl-2-oxobutyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40854425 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (5S)-5-(1-benzofuran-2-yl)-3-(3,3-dimethyl-2-oxobutyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC(C)(C)C(=O)CN1C(=O)N[C@@](C)(c2cc3ccccc3o2)C1=O |
| InChI | InChI=1S/C18H20N2O4/c1-17(2,3)13(21)10-20-15(22)18(4,19-16(20)23)14-9-11-7-5-6-8-12(11)24-14/h5-9H,10H2,1-4H3,(H,19,23)/t18-/m0/s1 |
| InChIKey | UINVNHNUFPXWIE-SFHVURJKSA-N |
| XLogP | 2.82 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|