C21H18N2O3 — CID 40767489
(5R)-5-(1-benzofuran-2-yl)-5-methyl-3-[(E)-3-phenylprop-2-enyl]imidazolidine-2,4-dione (PubChem CID 40767489) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is (5R)-5-(1-benzofuran-2-yl)-5-methyl-3-[(E)-3-phenylprop-2-enyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(1-benzofuran-2-yl)-5-methyl-3-[(E)-3-phenylprop-2-enyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40767489 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (5R)-5-(1-benzofuran-2-yl)-5-methyl-3-[(E)-3-phenylprop-2-enyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(c2cc3ccccc3o2)NC(=O)N(C/C=C/c2ccccc2)C1=O |
| InChI | InChI=1S/C21H18N2O3/c1-21(18-14-16-11-5-6-12-17(16)26-18)19(24)23(20(25)22-21)13-7-10-15-8-3-2-4-9-15/h2-12,14H,13H2,1H3,(H,22,25)/b10-7+/t21-/m1/s1 |
| InChIKey | SDRCCIJBGYJFIK-TYOLEZHBSA-N |
| XLogP | 3.91 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|