C23H27N3O4 — CID 41119322
(5R)-3-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-5-(1-benzofuran-2-yl)-5-methylimidazolidine-2,4-dione (PubChem CID 41119322) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is (5R)-3-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-5-(1-benzofuran-2-yl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-5-(1-benzofuran-2-yl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41119322 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (5R)-3-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-5-(1-benzofuran-2-yl)-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2cc3ccccc3o2)NC(=O)N(CC(=O)N2CCC[C@H]3CCCC[C@@H]32)C1=O |
| InChI | InChI=1S/C23H27N3O4/c1-23(19-13-16-8-3-5-11-18(16)30-19)21(28)26(22(29)24-23)14-20(27)25-12-6-9-15-7-2-4-10-17(15)25/h3,5,8,11,13,15,17H,2,4,6-7,9-10,12,14H2,1H3,(H,24,29)/t15-,17+,23-/m1/s1 |
| InChIKey | VZQUFYNMEQTFCH-LPXYKDPNSA-N |
| XLogP | 3.38 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|