C14H15BrN2O5S — CID 7794140
[2-(5-bromothiophen-2-yl)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7794140) has the molecular formula C14H15BrN2O5S and a molecular weight of 403.25 g/mol. Its IUPAC name is [2-(5-bromothiophen-2-yl)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [2-(5-bromothiophen-2-yl)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7794140 |
| Molecular Formula | C14H15BrN2O5S |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | [2-(5-bromothiophen-2-yl)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CC[C@]1(C)NC(=O)N(CC(=O)OCC(=O)c2ccc(Br)s2)C1=O |
| InChI | InChI=1S/C14H15BrN2O5S/c1-3-14(2)12(20)17(13(21)16-14)6-11(19)22-7-8(18)9-4-5-10(15)23-9/h4-5H,3,6-7H2,1-2H3,(H,16,21)/t14-/m0/s1 |
| InChIKey | QRYQKLAHGZHRLP-AWEZNQCLSA-N |
| XLogP | 1.96 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|