C23H21NO6 — CID 8728080
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 3-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 8728080) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 3-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 3-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 8728080 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 3-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | CCc1cc2c(COC(=O)c3cccc(N4CCCC4=O)c3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C23H21NO6/c1-2-14-10-18-16(11-22(27)30-20(18)12-19(14)25)13-29-23(28)15-5-3-6-17(9-15)24-8-4-7-21(24)26/h3,5-6,9-12,25H,2,4,7-8,13H2,1H3 |
| InChIKey | JFUIAVSWSHHTNF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|