About [4-amino-5-(1,3-benzoxazol-2-yl)-6-chloro-2-pyridinyl] butanoate
[4-amino-5-(1,3-benzoxazol-2-yl)-6-chloro-2-pyridinyl] butanoate (PubChem CID 174452571) has the molecular formula C16H14ClN3O3
and a molecular weight of 331.76 g/mol. Its IUPAC name is [4-amino-5-(1,3-benzoxazol-2-yl)-6-chloro-2-pyridinyl] butanoate.
Molecular Properties
| Compound Name | [4-amino-5-(1,3-benzoxazol-2-yl)-6-chloro-2-pyridinyl] butanoate |
| PubChem CID | 174452571 |
| Molecular Formula | C16H14ClN3O3 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | [4-amino-5-(1,3-benzoxazol-2-yl)-6-chloro-2-pyridinyl] butanoate |
| SMILES | CCCC(=O)Oc1cc(N)c(-c2nc3ccccc3o2)c(Cl)n1 |
| InChI | InChI=1S/C16H14ClN3O3/c1-2-5-13(21)23-12-8-9(18)14(15(17)20-12)16-19-10-6-3-4-7-11(10)22-16/h3-4,6-8H,2,5H2,1H3,(H2,18,20) |
| InChIKey | VWBMTSRZRXIVLJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [4-amino-5-(1,3-benzoxazol-2-yl)-6-chloro-2-pyridinyl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-amino-5-(1,3-benzoxazol-2-yl)-6-chloro-2-pyridinyl] butanoate?
The IUPAC name of [4-amino-5-(1,3-benzoxazol-2-yl)-6-chloro-2-pyridinyl] butanoate (CID 174452571) is [4-amino-5-(1,3-benzoxazol-2-yl)-6-chloro-2-pyridinyl] butanoate.
What is the SMILES notation for [4-amino-5-(1,3-benzoxazol-2-yl)-6-chloro-2-pyridinyl] butanoate?
The canonical SMILES for [4-amino-5-(1,3-benzoxazol-2-yl)-6-chloro-2-pyridinyl] butanoate is CCCC(=O)Oc1cc(N)c(-c2nc3ccccc3o2)c(Cl)n1.
What is the InChIKey of [4-amino-5-(1,3-benzoxazol-2-yl)-6-chloro-2-pyridinyl] butanoate?
The InChIKey is VWBMTSRZRXIVLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN3O3/c1-2-5-13(21)23-12-8-9(18)14(15(17)20-12)16-19-10-6-3-4-7-11(10)22-16/h3-4,6-8H,2,5H2,1H3,(H2,18,20).
What are the key properties of [4-amino-5-(1,3-benzoxazol-2-yl)-6-chloro-2-pyridinyl] butanoate?
[4-amino-5-(1,3-benzoxazol-2-yl)-6-chloro-2-pyridinyl] butanoate has a molecular weight of 331.76 g/mol, XLogP of 3.83, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-amino-5-(1,3-benzoxazol-2-yl)-6-chloro-2-pyridinyl] butanoate is sourced from PubChem (CID 174452571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).