C22H14N6O4 — CID 156623555
ethyl 2-[4,6-bis(1,3-benzoxazol-2-yl)-1,3,5-triazin-2-yl]-2-isocyanoacetate (PubChem CID 156623555) has the molecular formula C22H14N6O4 and a molecular weight of 426.39 g/mol. Its IUPAC name is ethyl 2-[4,6-bis(1,3-benzoxazol-2-yl)-1,3,5-triazin-2-yl]-2-isocyanoacetate.
| Compound Name | ethyl 2-[4,6-bis(1,3-benzoxazol-2-yl)-1,3,5-triazin-2-yl]-2-isocyanoacetate |
|---|---|
| PubChem CID | 156623555 |
| Molecular Formula | C22H14N6O4 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | ethyl 2-[4,6-bis(1,3-benzoxazol-2-yl)-1,3,5-triazin-2-yl]-2-isocyanoacetate |
| SMILES | [C-]#[N+]C(C(=O)OCC)c1nc(-c2nc3ccccc3o2)nc(-c2nc3ccccc3o2)n1 |
| InChI | InChI=1S/C22H14N6O4/c1-3-30-22(29)16(23-2)17-26-18(20-24-12-8-4-6-10-14(12)31-20)28-19(27-17)21-25-13-9-5-7-11-15(13)32-21/h4-11,16H,3H2,1H3 |
| InChIKey | GGWNJHIRPDHWNB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 121.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|