C23H9F7N6O4 — CID 170683263
ethyl 2-isocyano-2-[4-(4,5,6,7-tetrafluoro-1,3-benzoxazol-2-yl)-6-(4,5,6-trifluoro-7-methyl-1,3-benzoxazol-2-yl)-1,3,5-triazin-2-yl]acetate (PubChem CID 170683263) has the molecular formula C23H9F7N6O4 and a molecular weight of 566.35 g/mol. Its IUPAC name is ethyl 2-isocyano-2-[4-(4,5,6,7-tetrafluoro-1,3-benzoxazol-2-yl)-6-(4,5,6-trifluoro-7-methyl-1,3-benzoxazol-2-yl)-1,3,5-triazin-2-yl]acetate.
| Compound Name | ethyl 2-isocyano-2-[4-(4,5,6,7-tetrafluoro-1,3-benzoxazol-2-yl)-6-(4,5,6-trifluoro-7-methyl-1,3-benzoxazol-2-yl)-1,3,5-triazin-2-yl]acetate |
|---|---|
| PubChem CID | 170683263 |
| Molecular Formula | C23H9F7N6O4 |
| Molecular Weight | 566.35 g/mol |
| Exact Mass | 566.06 |
| IUPAC Name | ethyl 2-isocyano-2-[4-(4,5,6,7-tetrafluoro-1,3-benzoxazol-2-yl)-6-(4,5,6-trifluoro-7-methyl-1,3-benzoxazol-2-yl)-1,3,5-triazin-2-yl]acetate |
| SMILES | [C-]#[N+]C(C(=O)OCC)c1nc(-c2nc3c(F)c(F)c(F)c(C)c3o2)nc(-c2nc3c(F)c(F)c(F)c(F)c3o2)n1 |
| InChI | InChI=1S/C23H9F7N6O4/c1-4-38-23(37)15(31-3)18-34-19(21-32-13-10(28)7(25)6(24)5(2)16(13)39-21)36-20(35-18)22-33-14-11(29)8(26)9(27)12(30)17(14)40-22/h15H,4H2,1-2H3 |
| InChIKey | SQNIFKAHVUJTMF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 121.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.35 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|