C12H8ClN3O — CID 28692665
2-chloro-5-([1,3]oxazolo[4,5-c]pyridin-2-yl)aniline (PubChem CID 28692665) has the molecular formula C12H8ClN3O and a molecular weight of 245.67 g/mol. Its IUPAC name is 2-chloro-5-([1,3]oxazolo[4,5-c]pyridin-2-yl)aniline.
| Compound Name | 2-chloro-5-([1,3]oxazolo[4,5-c]pyridin-2-yl)aniline |
|---|---|
| PubChem CID | 28692665 |
| Molecular Formula | C12H8ClN3O |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-chloro-5-([1,3]oxazolo[4,5-c]pyridin-2-yl)aniline |
| SMILES | Nc1cc(-c2nc3cnccc3o2)ccc1Cl |
| InChI | InChI=1S/C12H8ClN3O/c13-8-2-1-7(5-9(8)14)12-16-10-6-15-4-3-11(10)17-12/h1-6H,14H2 |
| InChIKey | HIXYKQJOJGVLDK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|