C14H12N4OS — CID 30031811
[4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methylthiourea (PubChem CID 30031811) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methylthiourea.
| Compound Name | [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methylthiourea |
|---|---|
| PubChem CID | 30031811 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methylthiourea |
| SMILES | NC(=S)NCc1ccc(-c2nc3cnccc3o2)cc1 |
| InChI | InChI=1S/C14H12N4OS/c15-14(20)17-7-9-1-3-10(4-2-9)13-18-11-8-16-6-5-12(11)19-13/h1-6,8H,7H2,(H3,15,17,20) |
| InChIKey | ALKBRXQPIDLEAH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|