C12H6Cl2N2O — CID 91677485
2-(2,5-dichlorophenyl)-[1,3]oxazolo[4,5-c]pyridine (PubChem CID 91677485) has the molecular formula C12H6Cl2N2O and a molecular weight of 265.10 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-[1,3]oxazolo[4,5-c]pyridine.
| Compound Name | 2-(2,5-dichlorophenyl)-[1,3]oxazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 91677485 |
| Molecular Formula | C12H6Cl2N2O |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-[1,3]oxazolo[4,5-c]pyridine |
| SMILES | Clc1ccc(Cl)c(-c2nc3cnccc3o2)c1 |
| InChI | InChI=1S/C12H6Cl2N2O/c13-7-1-2-9(14)8(5-7)12-16-10-6-15-4-3-11(10)17-12/h1-6H |
| InChIKey | PCQAZZGEAWMHIW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |