C15H11Cl2NO — CID 95911056
2-(2,5-dichlorophenyl)-5,6-dimethyl-1,3-benzoxazole (PubChem CID 95911056) has the molecular formula C15H11Cl2NO and a molecular weight of 292.17 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-5,6-dimethyl-1,3-benzoxazole.
| Compound Name | 2-(2,5-dichlorophenyl)-5,6-dimethyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 95911056 |
| Molecular Formula | C15H11Cl2NO |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-5,6-dimethyl-1,3-benzoxazole |
| SMILES | Cc1cc2nc(-c3cc(Cl)ccc3Cl)oc2cc1C |
| InChI | InChI=1S/C15H11Cl2NO/c1-8-5-13-14(6-9(8)2)19-15(18-13)11-7-10(16)3-4-12(11)17/h3-7H,1-2H3 |
| InChIKey | SGPQVMIFZKDJBR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |