C21H16ClN3O2S2 — CID 1349188
N-[[4-chloro-3-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 1349188) has the molecular formula C21H16ClN3O2S2 and a molecular weight of 441.97 g/mol. Its IUPAC name is N-[[4-chloro-3-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[4-chloro-3-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1349188 |
| Molecular Formula | C21H16ClN3O2S2 |
| Molecular Weight | 441.97 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N-[[4-chloro-3-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | Cc1cc2nc(-c3cc(NC(=S)NC(=O)c4cccs4)ccc3Cl)oc2cc1C |
| InChI | InChI=1S/C21H16ClN3O2S2/c1-11-8-16-17(9-12(11)2)27-20(24-16)14-10-13(5-6-15(14)22)23-21(28)25-19(26)18-4-3-7-29-18/h3-10H,1-2H3,(H2,23,25,26,28) |
| InChIKey | FACDGLHFHAWNSV-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.97 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|