C22H15BrCl2N2O3 — CID 126256000
(5Z)-5-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-3-[(3,4-dichlorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126256000) has the molecular formula C22H15BrCl2N2O3 and a molecular weight of 506.18 g/mol. Its IUPAC name is (5Z)-5-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-3-[(3,4-dichlorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-3-[(3,4-dichlorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126256000 |
| Molecular Formula | C22H15BrCl2N2O3 |
| Molecular Weight | 506.18 g/mol |
| Exact Mass | 503.96 |
| IUPAC Name | (5Z)-5-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-3-[(3,4-dichlorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(-c2ccc(/C=C3\NC(=O)N(Cc4ccc(Cl)c(Cl)c4)C3=O)o2)c(Br)c1 |
| InChI | InChI=1S/C22H15BrCl2N2O3/c1-12-2-5-15(16(23)8-12)20-7-4-14(30-20)10-19-21(28)27(22(29)26-19)11-13-3-6-17(24)18(25)9-13/h2-10H,11H2,1H3,(H,26,29)/b19-10- |
| InChIKey | LTCILEFTOTZRBS-GRSHGNNSSA-N |
| XLogP | 6.42 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.18 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|