C16H13BrN2O3 — CID 126244506
(5E)-5-[(5-bromofuran-2-yl)methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126244506) has the molecular formula C16H13BrN2O3 and a molecular weight of 361.20 g/mol. Its IUPAC name is (5E)-5-[(5-bromofuran-2-yl)methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(5-bromofuran-2-yl)methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126244506 |
| Molecular Formula | C16H13BrN2O3 |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | (5E)-5-[(5-bromofuran-2-yl)methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(CN2C(=O)N/C(=C/c3ccc(Br)o3)C2=O)cc1 |
| InChI | InChI=1S/C16H13BrN2O3/c1-10-2-4-11(5-3-10)9-19-15(20)13(18-16(19)21)8-12-6-7-14(17)22-12/h2-8H,9H2,1H3,(H,18,21)/b13-8+ |
| InChIKey | WWWRUOCTOHWDCL-MDWZMJQESA-N |
| XLogP | 3.44 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|